About (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate
(4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate (PubChem CID 90940848) has the molecular formula C17H19N3O2
and a molecular weight of 297.36 g/mol. Its IUPAC name is (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate.
Molecular Properties
| Compound Name | (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate |
| PubChem CID | 90940848 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate |
| SMILES | CCCC(=O)On1cnc2c(C(C)C)nc3ccccc3c21 |
| InChI | InChI=1S/C17H19N3O2/c1-4-7-14(21)22-20-10-18-16-15(11(2)3)19-13-9-6-5-8-12(13)17(16)20/h5-6,8-11H,4,7H2,1-3H3 |
| InChIKey | HJTSYZXBBUVSDA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate?
The IUPAC name of (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate (CID 90940848) is (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate.
What is the SMILES notation for (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate?
The canonical SMILES for (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate is CCCC(=O)On1cnc2c(C(C)C)nc3ccccc3c21.
What is the InChIKey of (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate?
The InChIKey is HJTSYZXBBUVSDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2/c1-4-7-14(21)22-20-10-18-16-15(11(2)3)19-13-9-6-5-8-12(13)17(16)20/h5-6,8-11H,4,7H2,1-3H3.
What are the key properties of (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate?
(4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate has a molecular weight of 297.36 g/mol, XLogP of 3.46, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propan-2-ylimidazo[4,5-c]quinolin-1-yl) butanoate is sourced from PubChem (CID 90940848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).