C17H31NO3S — CID 90941396
1-amino-6-(2-ethylbutylsulfonyl)-4,8-dimethylnona-4,6,8-trien-3-ol (PubChem CID 90941396) has the molecular formula C17H31NO3S and a molecular weight of 329.51 g/mol. Its IUPAC name is 1-amino-6-(2-ethylbutylsulfonyl)-4,8-dimethylnona-4,6,8-trien-3-ol.
| Compound Name | 1-amino-6-(2-ethylbutylsulfonyl)-4,8-dimethylnona-4,6,8-trien-3-ol |
|---|---|
| PubChem CID | 90941396 |
| Molecular Formula | C17H31NO3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-amino-6-(2-ethylbutylsulfonyl)-4,8-dimethylnona-4,6,8-trien-3-ol |
| SMILES | C=C(C)C=C(C=C(C)C(O)CCN)S(=O)(=O)CC(CC)CC |
| InChI | InChI=1S/C17H31NO3S/c1-6-15(7-2)12-22(20,21)16(10-13(3)4)11-14(5)17(19)8-9-18/h10-11,15,17,19H,3,6-9,12,18H2,1-2,4-5H3 |
| InChIKey | ASAHFOBEBTXRNK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|