C27H36N6O2S2 — CID 90941448
6-cyclobut-2-en-1-yl-8-(methylamino)-5,8-dihydro-4H-[1,3]thiazolo[4,5-d]azepin-7-one;8-(methylamino)-6-(3-methylcyclohex-2-en-1-yl)-5,8-dihydro-4H-[1,3]thiazolo[4,5-d]azepin-7-one (PubChem CID 90941448) has the molecular formula C27H36N6O2S2 and a molecular weight of 540.76 g/mol. Its IUPAC name is 6-cyclobut-2-en-1-yl-8-(methylamino)-5,8-dihydro-4H-[1,3]thiazolo[4,5-d]azepin-7-one;8-(methylamino)-6-(3-methylcyclohex-2-en-1-yl)-5,8-dihydro-4H-[1,3]thiazolo[4,5-d]azepin-7-one.
| Compound Name | 6-cyclobut-2-en-1-yl-8-(methylamino)-5,8-dihydro-4H-[1,3]thiazolo[4,5-d]azepin-7-one;8-(methylamino)-6-(3-methylcyclohex-2-en-1-yl)-5,8-dihydro-4H-[1,3]thiazolo[4,5-d]azepin-7-one |
|---|---|
| PubChem CID | 90941448 |
| Molecular Formula | C27H36N6O2S2 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 6-cyclobut-2-en-1-yl-8-(methylamino)-5,8-dihydro-4H-[1,3]thiazolo[4,5-d]azepin-7-one;8-(methylamino)-6-(3-methylcyclohex-2-en-1-yl)-5,8-dihydro-4H-[1,3]thiazolo[4,5-d]azepin-7-one |
| SMILES | CNC1C(=O)N(C2C=C(C)CCC2)CCc2ncsc21.CNC1C(=O)N(C2C=CC2)CCc2ncsc21 |
| InChI | InChI=1S/C15H21N3OS.C12H15N3OS/c1-10-4-3-5-11(8-10)18-7-6-12-14(20-9-17-12)13(16-2)15(18)19;1-13-10-11-9(14-7-17-11)5-6-15(12(10)16)8-3-2-4-8/h8-9,11,13,16H,3-7H2,1-2H3;2-3,7-8,10,13H,4-6H2,1H3 |
| InChIKey | ZEHOKBWBOABQHL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|