C21H31N3O — CID 90941713
4-(3,4,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-1-ylmethyl)-N-hexylbenzamide (PubChem CID 90941713) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-(3,4,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-1-ylmethyl)-N-hexylbenzamide.
| Compound Name | 4-(3,4,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-1-ylmethyl)-N-hexylbenzamide |
|---|---|
| PubChem CID | 90941713 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 4-(3,4,8,8a-tetrahydro-2H-pyrrolo[1,2-a]pyrimidin-1-ylmethyl)-N-hexylbenzamide |
| SMILES | CCCCCCNC(=O)c1ccc(CN2CCCN3C=CCC32)cc1 |
| InChI | InChI=1S/C21H31N3O/c1-2-3-4-5-13-22-21(25)19-11-9-18(10-12-19)17-24-16-7-15-23-14-6-8-20(23)24/h6,9-12,14,20H,2-5,7-8,13,15-17H2,1H3,(H,22,25) |
| InChIKey | GBMMCFDQDNAAFL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|