C16H25F3O3 — CID 90941796
3-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-methylpropan-2-ol;methyl 2-methylprop-2-enoate (PubChem CID 90941796) has the molecular formula C16H25F3O3 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-methylpropan-2-ol;methyl 2-methylprop-2-enoate.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-methylpropan-2-ol;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90941796 |
| Molecular Formula | C16H25F3O3 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-methylpropan-2-ol;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.CC(O)(CC1CC2CCC1C2)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O.C5H8O2/c1-10(15,11(12,13)14)6-9-5-7-2-3-8(9)4-7;1-4(2)5(6)7-3/h7-9,15H,2-6H2,1H3;1H2,2-3H3 |
| InChIKey | OCDSWUOQRAZESU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|