About 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine
2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine (PubChem CID 90941822) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine.
Molecular Properties
| Compound Name | 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine |
| PubChem CID | 90941822 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine |
| SMILES | CC/N=C(C)/C(C)=N/C(C)C=C(C)C |
| InChI | InChI=1S/C12H22N2/c1-7-13-11(5)12(6)14-10(4)8-9(2)3/h8,10H,7H2,1-6H3/b13-11+,14-12+ |
| InChIKey | UYVKOSSZKXJYMI-PHEQNACWSA-N |
| XLogP | 3.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine?
The IUPAC name of 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine (CID 90941822) is 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine.
What is the SMILES notation for 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine?
The canonical SMILES for 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine is CC/N=C(C)/C(C)=N/C(C)C=C(C)C.
What is the InChIKey of 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine?
The InChIKey is UYVKOSSZKXJYMI-PHEQNACWSA-N. The full InChI is InChI=1S/C12H22N2/c1-7-13-11(5)12(6)14-10(4)8-9(2)3/h8,10H,7H2,1-6H3/b13-11+,14-12+.
What are the key properties of 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine?
2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine has a molecular weight of 194.32 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-3-N-(4-methylpent-3-en-2-yl)butane-2,3-diimine is sourced from PubChem (CID 90941822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).