C41H60ClN3O7 — CID 90941931
2-(3-benzyl-4-ethoxy-5-hydroxy-2-oxoimidazol-1-yl)-N-(4-chloro-2,5-dioctoxyphenyl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 90941931) has the molecular formula C41H60ClN3O7 and a molecular weight of 742.40 g/mol. Its IUPAC name is 2-(3-benzyl-4-ethoxy-5-hydroxy-2-oxoimidazol-1-yl)-N-(4-chloro-2,5-dioctoxyphenyl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | 2-(3-benzyl-4-ethoxy-5-hydroxy-2-oxoimidazol-1-yl)-N-(4-chloro-2,5-dioctoxyphenyl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 90941931 |
| Molecular Formula | C41H60ClN3O7 |
| Molecular Weight | 742.40 g/mol |
| Exact Mass | 741.41 |
| IUPAC Name | 2-(3-benzyl-4-ethoxy-5-hydroxy-2-oxoimidazol-1-yl)-N-(4-chloro-2,5-dioctoxyphenyl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCCCCCCCOc1cc(NC(=O)C(C(=O)C(C)(C)C)n2c(O)c(OCC)n(Cc3ccccc3)c2=O)c(OCCCCCCCC)cc1Cl |
| InChI | InChI=1S/C41H60ClN3O7/c1-7-10-12-14-16-21-25-51-33-28-32(34(27-31(33)42)52-26-22-17-15-13-11-8-2)43-37(47)35(36(46)41(4,5)6)45-38(48)39(50-9-3)44(40(45)49)29-30-23-19-18-20-24-30/h18-20,23-24,27-28,35,48H,7-17,21-22,25-26,29H2,1-6H3,(H,43,47) |
| InChIKey | NHHNQGUNQHOJHG-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.40 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|