C29H26ClF2N5O2S2 — CID 90942012
2-[[2-(6-chlorohepta-2,4,6-trien-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]-6-[2,2-difluoroethyl(methyl)amino]-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile (PubChem CID 90942012) has the molecular formula C29H26ClF2N5O2S2 and a molecular weight of 614.14 g/mol. Its IUPAC name is 2-[[2-(6-chlorohepta-2,4,6-trien-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]-6-[2,2-difluoroethyl(methyl)amino]-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-[[2-(6-chlorohepta-2,4,6-trien-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]-6-[2,2-difluoroethyl(methyl)amino]-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 90942012 |
| Molecular Formula | C29H26ClF2N5O2S2 |
| Molecular Weight | 614.14 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | 2-[[2-(6-chlorohepta-2,4,6-trien-3-yl)-1,3-thiazol-4-yl]methylsulfanyl]-6-[2,2-difluoroethyl(methyl)amino]-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
| SMILES | C=C(Cl)C=CC(=CC)c1nc(CSc2nc(N(C)CC(F)F)c(C#N)c(-c3ccc(OCCO)cc3)c2C#N)cs1 |
| InChI | InChI=1S/C29H26ClF2N5O2S2/c1-4-19(6-5-18(2)30)28-35-21(16-40-28)17-41-29-24(14-34)26(20-7-9-22(10-8-20)39-12-11-38)23(13-33)27(36-29)37(3)15-25(31)32/h4-10,16,25,38H,2,11-12,15,17H2,1,3H3 |
| InChIKey | DUNGINFAHODCMQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.14 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|