About N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine
N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine (PubChem CID 90942133) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine.
Molecular Properties
| Compound Name | N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine |
| PubChem CID | 90942133 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine |
| SMILES | CNN(C)N=c1cccccc1 |
| InChI | InChI=1S/C9H13N3/c1-10-12(2)11-9-7-5-3-4-6-8-9/h3-8,10H,1-2H3 |
| InChIKey | LQBWCYQFKQOBRV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine?
The IUPAC name of N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine (CID 90942133) is N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine.
What is the SMILES notation for N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine?
The canonical SMILES for N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine is CNN(C)N=c1cccccc1.
What is the InChIKey of N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine?
The InChIKey is LQBWCYQFKQOBRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-10-12(2)11-9-7-5-3-4-6-8-9/h3-8,10H,1-2H3.
What are the key properties of N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine?
N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine has a molecular weight of 163.22 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohepta-2,4,6-trien-1-ylideneamino)-N-(methylamino)methanamine is sourced from PubChem (CID 90942133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).