About 2-fluoroquinolizin-4-one
2-fluoroquinolizin-4-one (PubChem CID 90942420) has the molecular formula C9H6FNO
and a molecular weight of 163.15 g/mol. Its IUPAC name is 2-fluoroquinolizin-4-one.
Molecular Properties
| Compound Name | 2-fluoroquinolizin-4-one |
| PubChem CID | 90942420 |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 2-fluoroquinolizin-4-one |
| SMILES | O=c1cc(F)cc2ccccn12 |
| InChI | InChI=1S/C9H6FNO/c10-7-5-8-3-1-2-4-11(8)9(12)6-7/h1-6H |
| InChIKey | YYMZYTIPPFBOLB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoroquinolizin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroquinolizin-4-one?
The IUPAC name of 2-fluoroquinolizin-4-one (CID 90942420) is 2-fluoroquinolizin-4-one.
What is the SMILES notation for 2-fluoroquinolizin-4-one?
The canonical SMILES for 2-fluoroquinolizin-4-one is O=c1cc(F)cc2ccccn12.
What is the InChIKey of 2-fluoroquinolizin-4-one?
The InChIKey is YYMZYTIPPFBOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO/c10-7-5-8-3-1-2-4-11(8)9(12)6-7/h1-6H.
What are the key properties of 2-fluoroquinolizin-4-one?
2-fluoroquinolizin-4-one has a molecular weight of 163.15 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroquinolizin-4-one is sourced from PubChem (CID 90942420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).