C8H13N3O7P+ — CID 90942661
[(2S,3S,4R)-5-(5-amino-1H-imidazol-2-yl)-3,4-dihydroxyoxolane-2-carbonyl]-trihydroxyphosphanium (PubChem CID 90942661) has the molecular formula C8H13N3O7P+ and a molecular weight of 294.18 g/mol. Its IUPAC name is [(2S,3S,4R)-5-(5-amino-1H-imidazol-2-yl)-3,4-dihydroxyoxolane-2-carbonyl]-trihydroxyphosphanium.
| Compound Name | [(2S,3S,4R)-5-(5-amino-1H-imidazol-2-yl)-3,4-dihydroxyoxolane-2-carbonyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 90942661 |
| Molecular Formula | C8H13N3O7P+ |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | [(2S,3S,4R)-5-(5-amino-1H-imidazol-2-yl)-3,4-dihydroxyoxolane-2-carbonyl]-trihydroxyphosphanium |
| SMILES | Nc1cnc(C2O[C@H](C(=O)[P+](O)(O)O)[C@@H](O)[C@H]2O)[nH]1 |
| InChI | InChI=1S/C8H13N3O7P/c9-2-1-10-7(11-2)5-3(12)4(13)6(18-5)8(14)19(15,16)17/h1,3-6,12-13,15-17H,9H2,(H,10,11)/q+1/t3-,4+,5?,6+/m1/s1 |
| InChIKey | YQKBTHYDJAWHMJ-JTSAIASGSA-N |
| XLogP | -2.58 |
| TPSA | 182.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|