About 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine
6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine (PubChem CID 90942786) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine.
Analyze 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine?
The IUPAC name of 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine (CID 90942786) is 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine.
What is the SMILES notation for 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine?
The canonical SMILES for 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine is CC1=C(C)OCCNC1.
What is the InChIKey of 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine?
The InChIKey is RHMOXEOUGVIWGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-6-5-8-3-4-9-7(6)2/h8H,3-5H2,1-2H3.
What are the key properties of 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine?
6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine has a molecular weight of 127.19 g/mol, XLogP of 0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2,3,4,5-tetrahydro-1,4-oxazepine is sourced from PubChem (CID 90942786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).