C20H14ClFN4O2 — CID 90943450
1-[6-chloro-1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(1H-1,2,4-triazol-5-yl)propane-1,3-dione (PubChem CID 90943450) has the molecular formula C20H14ClFN4O2 and a molecular weight of 396.81 g/mol. Its IUPAC name is 1-[6-chloro-1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(1H-1,2,4-triazol-5-yl)propane-1,3-dione.
| Compound Name | 1-[6-chloro-1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(1H-1,2,4-triazol-5-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 90943450 |
| Molecular Formula | C20H14ClFN4O2 |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-[6-chloro-1-[(4-fluorophenyl)methyl]indol-3-yl]-3-(1H-1,2,4-triazol-5-yl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1cn(Cc2ccc(F)cc2)c2cc(Cl)ccc12)c1ncn[nH]1 |
| InChI | InChI=1S/C20H14ClFN4O2/c21-13-3-6-15-16(18(27)8-19(28)20-23-11-24-25-20)10-26(17(15)7-13)9-12-1-4-14(22)5-2-12/h1-7,10-11H,8-9H2,(H,23,24,25) |
| InChIKey | PCSLMGYZCRMZDY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|