C21H29FO4 — CID 90943494
[(2S,3R,9S,10R,13S,14S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] 2-fluoroacetate (PubChem CID 90943494) has the molecular formula C21H29FO4 and a molecular weight of 364.46 g/mol. Its IUPAC name is [(2S,3R,9S,10R,13S,14S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] 2-fluoroacetate.
| Compound Name | [(2S,3R,9S,10R,13S,14S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] 2-fluoroacetate |
|---|---|
| PubChem CID | 90943494 |
| Molecular Formula | C21H29FO4 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(2S,3R,9S,10R,13S,14S,17S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] 2-fluoroacetate |
| SMILES | C[C@]12CC[C@H]3C(=CC=C4C[C@@H](O)[C@@H](OC(=O)CF)C[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C21H29FO4/c1-20-8-7-15-13(14(20)5-6-18(20)24)4-3-12-9-16(23)17(10-21(12,15)2)26-19(25)11-22/h3-4,14-18,23-24H,5-11H2,1-2H3/t14-,15-,16+,17-,18-,20-,21-/m0/s1 |
| InChIKey | VMGSRDQIYZKDPP-GVNFVFRUSA-N |
| XLogP | 3.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |