C14H32N4O2 — CID 90943523
1-aminopropan-2-yl N,N-bis[3-(dimethylamino)propyl]carbamate (PubChem CID 90943523) has the molecular formula C14H32N4O2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-aminopropan-2-yl N,N-bis[3-(dimethylamino)propyl]carbamate.
| Compound Name | 1-aminopropan-2-yl N,N-bis[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 90943523 |
| Molecular Formula | C14H32N4O2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 1-aminopropan-2-yl N,N-bis[3-(dimethylamino)propyl]carbamate |
| SMILES | CC(CN)OC(=O)N(CCCN(C)C)CCCN(C)C |
| InChI | InChI=1S/C14H32N4O2/c1-13(12-15)20-14(19)18(10-6-8-16(2)3)11-7-9-17(4)5/h13H,6-12,15H2,1-5H3 |
| InChIKey | YMBBRHZQHFSZQT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |