C37H59O5PSi2 — CID 90943928
tert-butyl-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-diphenylphosphorylethyl)-6-[3-(methoxymethoxy)propylidene]cyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 90943928) has the molecular formula C37H59O5PSi2 and a molecular weight of 671.02 g/mol. Its IUPAC name is tert-butyl-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-diphenylphosphorylethyl)-6-[3-(methoxymethoxy)propylidene]cyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-diphenylphosphorylethyl)-6-[3-(methoxymethoxy)propylidene]cyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 90943928 |
| Molecular Formula | C37H59O5PSi2 |
| Molecular Weight | 671.02 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | tert-butyl-[(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2-diphenylphosphorylethyl)-6-[3-(methoxymethoxy)propylidene]cyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | COCOCCC=C1[C@H](O[Si](C)(C)C(C)(C)C)C=C(CCP(=O)(c2ccccc2)c2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H59O5PSi2/c1-36(2,3)44(8,9)41-34-27-30(24-26-43(38,31-19-14-12-15-20-31)32-21-16-13-17-22-32)28-35(42-45(10,11)37(4,5)6)33(34)23-18-25-40-29-39-7/h12-17,19-23,27,34-35H,18,24-26,28-29H2,1-11H3/t34-,35-/m1/s1 |
| InChIKey | CDDXOVYQCKCLHU-VSJLXWSYSA-N |
| XLogP | 9.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.02 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|