About 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane
4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane (PubChem CID 90944409) has the molecular formula C15H16Cl3FNP
and a molecular weight of 366.63 g/mol. Its IUPAC name is 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane.
Molecular Properties
| Compound Name | 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane |
| PubChem CID | 90944409 |
| Molecular Formula | C15H16Cl3FNP |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane |
| SMILES | Cc1cccc(CCNc2ccc(F)cc2)c1.ClP(Cl)Cl |
| InChI | InChI=1S/C15H16FN.Cl3P/c1-12-3-2-4-13(11-12)9-10-17-15-7-5-14(16)6-8-15;1-4(2)3/h2-8,11,17H,9-10H2,1H3; |
| InChIKey | PKQLVCXFZRWGLR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane?
The IUPAC name of 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane (CID 90944409) is 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane.
What is the SMILES notation for 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane?
The canonical SMILES for 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane is Cc1cccc(CCNc2ccc(F)cc2)c1.ClP(Cl)Cl.
What is the InChIKey of 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane?
The InChIKey is PKQLVCXFZRWGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN.Cl3P/c1-12-3-2-4-13(11-12)9-10-17-15-7-5-14(16)6-8-15;1-4(2)3/h2-8,11,17H,9-10H2,1H3;.
What are the key properties of 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane?
4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane has a molecular weight of 366.63 g/mol, XLogP of 6.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-[2-(3-methylphenyl)ethyl]aniline;trichlorophosphane is sourced from PubChem (CID 90944409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).