C10H4F5NO2S2 — CID 90944527
S-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-sulfanylideneethanethioate (PubChem CID 90944527) has the molecular formula C10H4F5NO2S2 and a molecular weight of 329.27 g/mol. Its IUPAC name is S-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-sulfanylideneethanethioate.
| Compound Name | S-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-sulfanylideneethanethioate |
|---|---|
| PubChem CID | 90944527 |
| Molecular Formula | C10H4F5NO2S2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | S-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-sulfanylideneethanethioate |
| SMILES | O=C(CSC(=O)C=S)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H4F5NO2S2/c11-5-6(12)8(14)10(9(15)7(5)13)16-3(17)2-20-4(18)1-19/h1H,2H2,(H,16,17) |
| InChIKey | HEONVUZUDXICIH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|