C30H50O — CID 90944573
2-(4,8-dimethylnon-1-enyl)-2-methyl-6-nonyl-3,4-dihydrochromene (PubChem CID 90944573) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is 2-(4,8-dimethylnon-1-enyl)-2-methyl-6-nonyl-3,4-dihydrochromene.
| Compound Name | 2-(4,8-dimethylnon-1-enyl)-2-methyl-6-nonyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 90944573 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 2-(4,8-dimethylnon-1-enyl)-2-methyl-6-nonyl-3,4-dihydrochromene |
| SMILES | CCCCCCCCCc1ccc2c(c1)CCC(C)(C=CCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C30H50O/c1-6-7-8-9-10-11-12-18-27-19-20-29-28(24-27)21-23-30(5,31-29)22-14-17-26(4)16-13-15-25(2)3/h14,19-20,22,24-26H,6-13,15-18,21,23H2,1-5H3 |
| InChIKey | ZZJFKDJNBNMBHG-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|