C36H49F2N5O2 — CID 90944705
4-[1-[8-tert-butyl-2-(3,5-difluorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-[2-(methyldiazenyl)propyl]benzamide (PubChem CID 90944705) has the molecular formula C36H49F2N5O2 and a molecular weight of 621.82 g/mol. Its IUPAC name is 4-[1-[8-tert-butyl-2-(3,5-difluorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-[2-(methyldiazenyl)propyl]benzamide.
| Compound Name | 4-[1-[8-tert-butyl-2-(3,5-difluorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-[2-(methyldiazenyl)propyl]benzamide |
|---|---|
| PubChem CID | 90944705 |
| Molecular Formula | C36H49F2N5O2 |
| Molecular Weight | 621.82 g/mol |
| Exact Mass | 621.39 |
| IUPAC Name | 4-[1-[8-tert-butyl-2-(3,5-difluorophenyl)-3-oxo-1,4-diazaspiro[4.5]dec-1-en-4-yl]-4,4-dimethylpentyl]-N-[2-(methyldiazenyl)propyl]benzamide |
| SMILES | C/N=N/C(C)CNC(=O)c1ccc(C(CCC(C)(C)C)N2C(=O)C(c3cc(F)cc(F)c3)=NC23CCC(C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C36H49F2N5O2/c1-23(42-39-8)22-40-32(44)25-11-9-24(10-12-25)30(15-16-34(2,3)4)43-33(45)31(26-19-28(37)21-29(38)20-26)41-36(43)17-13-27(14-18-36)35(5,6)7/h9-12,19-21,23,27,30H,13-18,22H2,1-8H3,(H,40,44)/b42-39+ |
| InChIKey | XXBWXFUUQCAHHR-VJSBBTEDSA-N |
| XLogP | 8.30 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.82 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|