C21H18F3N3O2S2 — CID 90945044
4,4,4-trifluoro-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-3-N-(pyridin-2-ylmethyl)butane-1,3-diimine (PubChem CID 90945044) has the molecular formula C21H18F3N3O2S2 and a molecular weight of 465.52 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-3-N-(pyridin-2-ylmethyl)butane-1,3-diimine.
| Compound Name | 4,4,4-trifluoro-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-3-N-(pyridin-2-ylmethyl)butane-1,3-diimine |
|---|---|
| PubChem CID | 90945044 |
| Molecular Formula | C21H18F3N3O2S2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 4,4,4-trifluoro-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-3-N-(pyridin-2-ylmethyl)butane-1,3-diimine |
| SMILES | [H]/N=C(\C/C(=N/Cc1ccccn1)C(F)(F)F)c1ccc(-c2cccc(S(C)(=O)=O)c2)s1 |
| InChI | InChI=1S/C21H18F3N3O2S2/c1-31(28,29)16-7-4-5-14(11-16)18-8-9-19(30-18)17(25)12-20(21(22,23)24)27-13-15-6-2-3-10-26-15/h2-11,25H,12-13H2,1H3/b25-17+,27-20- |
| InChIKey | QIDCOADPKQIZBA-LWCBYISTSA-N |
| XLogP | 5.18 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|