C23H28FN3O — CID 90945132
N-[1-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]but-3-en-2-yl]acetamide (PubChem CID 90945132) has the molecular formula C23H28FN3O and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[1-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]but-3-en-2-yl]acetamide.
| Compound Name | N-[1-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]but-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 90945132 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[1-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]but-3-en-2-yl]acetamide |
| SMILES | [H]/N=C/C1CC2(C)C(=C/C1=N\c1ccc(F)cc1)CCC2CC(C=C)NC(C)=O |
| InChI | InChI=1S/C23H28FN3O/c1-4-20(26-15(2)28)11-17-5-6-18-12-22(16(14-25)13-23(17,18)3)27-21-9-7-19(24)8-10-21/h4,7-10,12,14,16-17,20,25H,1,5-6,11,13H2,2-3H3,(H,26,28)/b25-14+,27-22+ |
| InChIKey | AHGUPBFQYAXFGL-ITDQDEJLSA-N |
| XLogP | 4.99 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|