About ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate
ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate (PubChem CID 90945138) has the molecular formula C15H16F3NO3
and a molecular weight of 315.29 g/mol. Its IUPAC name is ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate.
Molecular Properties
| Compound Name | ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate |
| PubChem CID | 90945138 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate |
| SMILES | CC.[C-]#[N+]/C(C(=O)OCCc1ccccc1)=C(/O)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO3.C2H6/c1-17-10(11(18)13(14,15)16)12(19)20-8-7-9-5-3-2-4-6-9;1-2/h2-6,18H,7-8H2;1-2H3/b11-10+; |
| InChIKey | QTNZZXDZGOJUSI-ASTDGNLGSA-N |
| XLogP | 4.05 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate?
The IUPAC name of ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate (CID 90945138) is ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate.
What is the SMILES notation for ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate?
The canonical SMILES for ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate is CC.[C-]#[N+]/C(C(=O)OCCc1ccccc1)=C(/O)C(F)(F)F.
What is the InChIKey of ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate?
The InChIKey is QTNZZXDZGOJUSI-ASTDGNLGSA-N. The full InChI is InChI=1S/C13H10F3NO3.C2H6/c1-17-10(11(18)13(14,15)16)12(19)20-8-7-9-5-3-2-4-6-9;1-2/h2-6,18H,7-8H2;1-2H3/b11-10+;.
What are the key properties of ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate?
ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate has a molecular weight of 315.29 g/mol, XLogP of 4.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-phenylethyl (E)-4,4,4-trifluoro-3-hydroxy-2-isocyanobut-2-enoate is sourced from PubChem (CID 90945138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).