C20H18FNO8 — CID 90945340
(4aR,5S,5aR,6R,12aS)-9-fluoro-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90945340) has the molecular formula C20H18FNO8 and a molecular weight of 419.36 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-9-fluoro-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-9-fluoro-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90945340 |
| Molecular Formula | C20H18FNO8 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-9-fluoro-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2ccc(F)c(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H18FNO8/c1-5-6-2-3-8(21)15(25)11(6)16(26)13-10(5)14(24)7-4-9(23)12(19(22)29)17(27)20(7,30)18(13)28/h2-3,5,7,10,12-14,24-25,30H,4H2,1H3,(H2,22,29)/t5-,7+,10+,12?,13?,14+,20+/m0/s1 |
| InChIKey | WJJIXDNJOZAELO-KEUXCKIGSA-N |
| XLogP | -1.00 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|