C20H24F12O4 — CID 90945462
2-[[3,5-bis[4,4,4-trifluoro-2-hydroxy-2-(trifluoromethyl)butyl]cyclohexyl]methyl]prop-2-enoic acid (PubChem CID 90945462) has the molecular formula C20H24F12O4 and a molecular weight of 556.38 g/mol. Its IUPAC name is 2-[[3,5-bis[4,4,4-trifluoro-2-hydroxy-2-(trifluoromethyl)butyl]cyclohexyl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3,5-bis[4,4,4-trifluoro-2-hydroxy-2-(trifluoromethyl)butyl]cyclohexyl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90945462 |
| Molecular Formula | C20H24F12O4 |
| Molecular Weight | 556.38 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-[[3,5-bis[4,4,4-trifluoro-2-hydroxy-2-(trifluoromethyl)butyl]cyclohexyl]methyl]prop-2-enoic acid |
| SMILES | C=C(CC1CC(CC(O)(CC(F)(F)F)C(F)(F)F)CC(CC(O)(CC(F)(F)F)C(F)(F)F)C1)C(=O)O |
| InChI | InChI=1S/C20H24F12O4/c1-10(14(33)34)2-11-3-12(6-15(35,19(27,28)29)8-17(21,22)23)5-13(4-11)7-16(36,20(30,31)32)9-18(24,25)26/h11-13,35-36H,1-9H2,(H,33,34) |
| InChIKey | ILRQVDCFCOTKIN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.38 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|