About [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol
[7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol (PubChem CID 90945527) has the molecular formula C16H18BrN3O
and a molecular weight of 348.24 g/mol. Its IUPAC name is [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol.
Molecular Properties
| Compound Name | [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol |
| PubChem CID | 90945527 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol |
| SMILES | CC1=CN(Nc2cc(CO)c3ccc(Br)cc3n2)CC1C |
| InChI | InChI=1S/C16H18BrN3O/c1-10-7-20(8-11(10)2)19-16-5-12(9-21)14-4-3-13(17)6-15(14)18-16/h3-7,11,21H,8-9H2,1-2H3,(H,18,19) |
| InChIKey | KFTXHSCIYVFUDX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol?
The IUPAC name of [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol (CID 90945527) is [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol.
What is the SMILES notation for [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol?
The canonical SMILES for [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol is CC1=CN(Nc2cc(CO)c3ccc(Br)cc3n2)CC1C.
What is the InChIKey of [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol?
The InChIKey is KFTXHSCIYVFUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrN3O/c1-10-7-20(8-11(10)2)19-16-5-12(9-21)14-4-3-13(17)6-15(14)18-16/h3-7,11,21H,8-9H2,1-2H3,(H,18,19).
What are the key properties of [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol?
[7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol has a molecular weight of 348.24 g/mol, XLogP of 3.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-bromo-2-[(3,4-dimethyl-2,3-dihydropyrrol-1-yl)amino]quinolin-4-yl]methanol is sourced from PubChem (CID 90945527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).