C24H30Cl3NO6Si — CID 90945674
[(3R,4S,5S,6R)-2-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,2,2-trichloroethanimidate (PubChem CID 90945674) has the molecular formula C24H30Cl3NO6Si and a molecular weight of 562.95 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-2-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4S,5S,6R)-2-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 90945674 |
| Molecular Formula | C24H30Cl3NO6Si |
| Molecular Weight | 562.95 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | [(3R,4S,5S,6R)-2-[tert-butyl(diphenyl)silyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C24H30Cl3NO6Si/c1-23(2,3)35(15-10-6-4-7-11-15,16-12-8-5-9-13-16)34-21-20(33-22(28)24(25,26)27)19(31)18(30)17(14-29)32-21/h4-13,17-21,28-31H,14H2,1-3H3/b28-22+/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | VEOZMYQYWPJKRS-IKJOQGPYSA-N |
| XLogP | 2.73 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.95 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|