C10H19NO2 — CID 90946142
(2S)-2-[(4R)-2,2-dimethyl-1,3-oxazolidin-4-yl]pent-4-en-2-ol (PubChem CID 90946142) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (2S)-2-[(4R)-2,2-dimethyl-1,3-oxazolidin-4-yl]pent-4-en-2-ol.
| Compound Name | (2S)-2-[(4R)-2,2-dimethyl-1,3-oxazolidin-4-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 90946142 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (2S)-2-[(4R)-2,2-dimethyl-1,3-oxazolidin-4-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@](C)(O)[C@H]1COC(C)(C)N1 |
| InChI | InChI=1S/C10H19NO2/c1-5-6-10(4,12)8-7-13-9(2,3)11-8/h5,8,11-12H,1,6-7H2,2-4H3/t8-,10+/m1/s1 |
| InChIKey | MDHIDRCSZDGMDI-SCZZXKLOSA-N |
| XLogP | 1.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|