About 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide
2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 90946193) has the molecular formula C19H16F6N2O3
and a molecular weight of 434.34 g/mol. Its IUPAC name is 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| PubChem CID | 90946193 |
| Molecular Formula | C19H16F6N2O3 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)C(=NOC)c1ccccc1COc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F6N2O3/c1-26-17(28)16(27-29-2)15-6-4-3-5-11(15)10-30-14-8-12(18(20,21)22)7-13(9-14)19(23,24)25/h3-9H,10H2,1-2H3,(H,26,28) |
| InChIKey | CBUDXKSTBTYOMW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide?
The IUPAC name of 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide (CID 90946193) is 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide.
What is the SMILES notation for 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide?
The canonical SMILES for 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide is CNC(=O)C(=NOC)c1ccccc1COc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide?
The InChIKey is CBUDXKSTBTYOMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F6N2O3/c1-26-17(28)16(27-29-2)15-6-4-3-5-11(15)10-30-14-8-12(18(20,21)22)7-13(9-14)19(23,24)25/h3-9H,10H2,1-2H3,(H,26,28).
What are the key properties of 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide?
2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide has a molecular weight of 434.34 g/mol, XLogP of 4.40, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]-2-methoxyimino-N-methylacetamide is sourced from PubChem (CID 90946193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).