C19H20ClFN3O6PS — CID 90946603
4-[4-chloro-5-(4-ethoxy-3-fluorophenyl)imidazol-1-yl]-N-dimethoxyphosphorylbenzenesulfonamide (PubChem CID 90946603) has the molecular formula C19H20ClFN3O6PS and a molecular weight of 503.88 g/mol. Its IUPAC name is 4-[4-chloro-5-(4-ethoxy-3-fluorophenyl)imidazol-1-yl]-N-dimethoxyphosphorylbenzenesulfonamide.
| Compound Name | 4-[4-chloro-5-(4-ethoxy-3-fluorophenyl)imidazol-1-yl]-N-dimethoxyphosphorylbenzenesulfonamide |
|---|---|
| PubChem CID | 90946603 |
| Molecular Formula | C19H20ClFN3O6PS |
| Molecular Weight | 503.88 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 4-[4-chloro-5-(4-ethoxy-3-fluorophenyl)imidazol-1-yl]-N-dimethoxyphosphorylbenzenesulfonamide |
| SMILES | CCOc1ccc(-c2c(Cl)ncn2-c2ccc(S(=O)(=O)NP(=O)(OC)OC)cc2)cc1F |
| InChI | InChI=1S/C19H20ClFN3O6PS/c1-4-30-17-10-5-13(11-16(17)21)18-19(20)22-12-24(18)14-6-8-15(9-7-14)32(26,27)23-31(25,28-2)29-3/h5-12H,4H2,1-3H3,(H,23,25) |
| InChIKey | GPPFFIDTULGGAU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|