methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate

C12H16N2O3 — CID 90946670

IUPACmethyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate
SMILESCCN1CNc2c(OC)cc(C(=O)OC)cc21
InChIInChI=1S/C12H16N2O3/c1-4-14-7-13-11-9(14)5-8(12(15)17-3)6-10(11)16-2/h5-6,13H,4,7H2,1-3H3
InChIKeyGUIOLEKJTQXJDZ-UHFFFAOYSA-N
MW236.27 g/mol
LogP1.69
Rot. Bonds3

About methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate

methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate (PubChem CID 90946670) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate
PubChem CID90946670
Molecular FormulaC12H16N2O3
Molecular Weight236.27 g/mol
Exact Mass236.12
IUPAC Namemethyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate
SMILESCCN1CNc2c(OC)cc(C(=O)OC)cc21
InChIInChI=1S/C12H16N2O3/c1-4-14-7-13-11-9(14)5-8(12(15)17-3)6-10(11)16-2/h5-6,13H,4,7H2,1-3H3
InChIKeyGUIOLEKJTQXJDZ-UHFFFAOYSA-N
XLogP1.69
TPSA50.80 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate?
The IUPAC name of methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate (CID 90946670) is methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate.
What is the SMILES notation for methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate?
The canonical SMILES for methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate is CCN1CNc2c(OC)cc(C(=O)OC)cc21.
What is the InChIKey of methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate?
The InChIKey is GUIOLEKJTQXJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c1-4-14-7-13-11-9(14)5-8(12(15)17-3)6-10(11)16-2/h5-6,13H,4,7H2,1-3H3.
What are the key properties of methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate?
methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate has a molecular weight of 236.27 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-ethyl-7-methoxy-1,2-dihydrobenzimidazole-5-carboxylate is sourced from PubChem (CID 90946670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).