C25H50N4 — CID 90947103
3-imino-1-N'-methyl-1-N'-[9-methyl-3,5-di(propan-2-yl)dec-2-en-4-yl]-2-propyliminobutane-1,1-diamine (PubChem CID 90947103) has the molecular formula C25H50N4 and a molecular weight of 406.70 g/mol. Its IUPAC name is 3-imino-1-N'-methyl-1-N'-[9-methyl-3,5-di(propan-2-yl)dec-2-en-4-yl]-2-propyliminobutane-1,1-diamine.
| Compound Name | 3-imino-1-N'-methyl-1-N'-[9-methyl-3,5-di(propan-2-yl)dec-2-en-4-yl]-2-propyliminobutane-1,1-diamine |
|---|---|
| PubChem CID | 90947103 |
| Molecular Formula | C25H50N4 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 406.40 |
| IUPAC Name | 3-imino-1-N'-methyl-1-N'-[9-methyl-3,5-di(propan-2-yl)dec-2-en-4-yl]-2-propyliminobutane-1,1-diamine |
| SMILES | [H]/N=C(C)/C(=N\CCC)C(N)N(C)C(C(=CC)C(C)C)C(CCCC(C)C)C(C)C |
| InChI | InChI=1S/C25H50N4/c1-11-16-28-23(20(9)26)25(27)29(10)24(21(12-2)18(5)6)22(19(7)8)15-13-14-17(3)4/h12,17-19,22,24-26H,11,13-16,27H2,1-10H3/b21-12?,26-20+,28-23+ |
| InChIKey | OGGLBEOYWOMWBO-AEMYFRBYSA-N |
| XLogP | 6.16 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|