C14H20N2O3S — CID 90947719
methyl 5-[(4-methoxyphenyl)methyl]-4,4-dimethyl-1,2,5-thiadiazolidine-2-carboxylate (PubChem CID 90947719) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is methyl 5-[(4-methoxyphenyl)methyl]-4,4-dimethyl-1,2,5-thiadiazolidine-2-carboxylate.
| Compound Name | methyl 5-[(4-methoxyphenyl)methyl]-4,4-dimethyl-1,2,5-thiadiazolidine-2-carboxylate |
|---|---|
| PubChem CID | 90947719 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 5-[(4-methoxyphenyl)methyl]-4,4-dimethyl-1,2,5-thiadiazolidine-2-carboxylate |
| SMILES | COC(=O)N1CC(C)(C)N(Cc2ccc(OC)cc2)S1 |
| InChI | InChI=1S/C14H20N2O3S/c1-14(2)10-15(13(17)19-4)20-16(14)9-11-5-7-12(18-3)8-6-11/h5-8H,9-10H2,1-4H3 |
| InChIKey | ADOUNBXYRXTRPY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|