About methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol
methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol (PubChem CID 90947809) has the molecular formula C15H30B2N2O3
and a molecular weight of 308.04 g/mol. Its IUPAC name is methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol.
Molecular Properties
| Compound Name | methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol |
| PubChem CID | 90947809 |
| Molecular Formula | C15H30B2N2O3 |
| Molecular Weight | 308.04 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol |
| SMILES | CB(O)N1CCCC(C)C1.CC1CCCNC1.O=BC#CO |
| InChI | InChI=1S/C7H16BNO.C6H13N.C2HBO2/c1-7-4-3-5-9(6-7)8(2)10;1-6-3-2-4-7-5-6;4-2-1-3-5/h7,10H,3-6H2,1-2H3;6-7H,2-5H2,1H3;4H |
| InChIKey | OWOVERWOBYRRCI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.04 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol?
The IUPAC name of methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol (CID 90947809) is methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol.
What is the SMILES notation for methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol?
The canonical SMILES for methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol is CB(O)N1CCCC(C)C1.CC1CCCNC1.O=BC#CO.
What is the InChIKey of methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol?
The InChIKey is OWOVERWOBYRRCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16BNO.C6H13N.C2HBO2/c1-7-4-3-5-9(6-7)8(2)10;1-6-3-2-4-7-5-6;4-2-1-3-5/h7,10H,3-6H2,1-2H3;6-7H,2-5H2,1H3;4H.
What are the key properties of methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol?
methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol has a molecular weight of 308.04 g/mol, XLogP of 1.16, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(3-methylpiperidin-1-yl)borinic acid;3-methylpiperidine;2-oxoboranylethynol is sourced from PubChem (CID 90947809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).