C21H31N2O7PS — CID 90948248
(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(4-oxo-6-phosphanyloxy-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)non-6-enamide (PubChem CID 90948248) has the molecular formula C21H31N2O7PS and a molecular weight of 486.53 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(4-oxo-6-phosphanyloxy-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)non-6-enamide.
| Compound Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(4-oxo-6-phosphanyloxy-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)non-6-enamide |
|---|---|
| PubChem CID | 90948248 |
| Molecular Formula | C21H31N2O7PS |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-(4-oxo-6-phosphanyloxy-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)non-6-enamide |
| SMILES | CO[C@@H](C(=O)NC1CSc2cccc(OP)c2NC1=O)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C |
| InChI | InChI=1S/C21H31N2O7PS/c1-21(2,3)9-8-12(24)16(25)17(26)18(29-4)20(28)22-11-10-32-14-7-5-6-13(30-31)15(14)23-19(11)27/h5-9,11-12,16-18,24-26H,10,31H2,1-4H3,(H,22,28)(H,23,27)/t11?,12-,16+,17-,18-/m1/s1 |
| InChIKey | BWRKFUYMLRXGCD-UDBYOQPDSA-N |
| XLogP | 1.08 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|