About but-1-ene;3-methylhexane
but-1-ene;3-methylhexane (PubChem CID 90948469) has the molecular formula C11H24
and a molecular weight of 156.31 g/mol. Its IUPAC name is but-1-ene;3-methylhexane.
Molecular Properties
| Compound Name | but-1-ene;3-methylhexane |
| PubChem CID | 90948469 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | but-1-ene;3-methylhexane |
| SMILES | C=CCC.CCCC(C)CC |
| InChI | InChI=1S/C7H16.C4H8/c1-4-6-7(3)5-2;1-3-4-2/h7H,4-6H2,1-3H3;3H,1,4H2,2H3 |
| InChIKey | GXBSVCWZNHTZKG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;3-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;3-methylhexane?
The IUPAC name of but-1-ene;3-methylhexane (CID 90948469) is but-1-ene;3-methylhexane.
What is the SMILES notation for but-1-ene;3-methylhexane?
The canonical SMILES for but-1-ene;3-methylhexane is C=CCC.CCCC(C)CC.
What is the InChIKey of but-1-ene;3-methylhexane?
The InChIKey is GXBSVCWZNHTZKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C4H8/c1-4-6-7(3)5-2;1-3-4-2/h7H,4-6H2,1-3H3;3H,1,4H2,2H3.
What are the key properties of but-1-ene;3-methylhexane?
but-1-ene;3-methylhexane has a molecular weight of 156.31 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;3-methylhexane is sourced from PubChem (CID 90948469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).