C9H11NO — CID 90948820
4,5,5a,9a-tetrahydro-1,5-benzoxazepine (PubChem CID 90948820) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 4,5,5a,9a-tetrahydro-1,5-benzoxazepine.
| Compound Name | 4,5,5a,9a-tetrahydro-1,5-benzoxazepine |
|---|---|
| PubChem CID | 90948820 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 4,5,5a,9a-tetrahydro-1,5-benzoxazepine |
| SMILES | C1=CC2NCC=COC2C=C1 |
| InChI | InChI=1S/C9H11NO/c1-2-5-9-8(4-1)10-6-3-7-11-9/h1-5,7-10H,6H2 |
| InChIKey | BFSJHHWXGCOWPS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |