C21H21NO6 — CID 90949396
benzyl (4aR,7aS)-5-oxo-2-phenylmethoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazine-4-carboxylate (PubChem CID 90949396) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is benzyl (4aR,7aS)-5-oxo-2-phenylmethoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazine-4-carboxylate.
| Compound Name | benzyl (4aR,7aS)-5-oxo-2-phenylmethoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazine-4-carboxylate |
|---|---|
| PubChem CID | 90949396 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | benzyl (4aR,7aS)-5-oxo-2-phenylmethoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazine-4-carboxylate |
| SMILES | O=C1OC[C@H]2OC(OCc3ccccc3)CN(C(=O)OCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C21H21NO6/c23-20-19-17(14-26-20)28-18(25-12-15-7-3-1-4-8-15)11-22(19)21(24)27-13-16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t17-,18?,19-/m1/s1 |
| InChIKey | UVDKZAAPTDYMIG-ZYYFHIKCSA-N |
| XLogP | 2.49 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |