C22H18N4O+2 — CID 90949422
5,19,21-trimethyl-12-oxa-2,18-diaza-5,22-diazoniaheptacyclo[11.9.1.11,7.02,6.017,23.018,22.011,24]tetracosa-3,5,7(24),8,10,13,15,17(23),19,21-decaene (PubChem CID 90949422) has the molecular formula C22H18N4O+2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5,19,21-trimethyl-12-oxa-2,18-diaza-5,22-diazoniaheptacyclo[11.9.1.11,7.02,6.017,23.018,22.011,24]tetracosa-3,5,7(24),8,10,13,15,17(23),19,21-decaene.
| Compound Name | 5,19,21-trimethyl-12-oxa-2,18-diaza-5,22-diazoniaheptacyclo[11.9.1.11,7.02,6.017,23.018,22.011,24]tetracosa-3,5,7(24),8,10,13,15,17(23),19,21-decaene |
|---|---|
| PubChem CID | 90949422 |
| Molecular Formula | C22H18N4O+2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 5,19,21-trimethyl-12-oxa-2,18-diaza-5,22-diazoniaheptacyclo[11.9.1.11,7.02,6.017,23.018,22.011,24]tetracosa-3,5,7(24),8,10,13,15,17(23),19,21-decaene |
| SMILES | Cc1cc(C)[n+]2n1-c1cccc3c1C21c2c(cccc2-c2n1cc[n+]2C)O3 |
| InChI | InChI=1S/C22H18N4O/c1-13-12-14(2)26-22-19-15(21-23(3)10-11-24(21)22)6-4-8-17(19)27-18-9-5-7-16(20(18)22)25(13)26/h4-12H,1-3H3/q+2 |
| InChIKey | VNDZAELFBZFJSF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|