C25H22O9 — CID 90949471
3-oxo-2-pyren-1-yl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoic acid (PubChem CID 90949471) has the molecular formula C25H22O9 and a molecular weight of 466.44 g/mol. Its IUPAC name is 3-oxo-2-pyren-1-yl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoic acid.
| Compound Name | 3-oxo-2-pyren-1-yl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 90949471 |
| Molecular Formula | C25H22O9 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 3-oxo-2-pyren-1-yl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoic acid |
| SMILES | O=C(O)C(C(=O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C25H22O9/c26-10-16-20(27)21(28)22(29)25(33-16)34-24(32)19(23(30)31)15-9-7-13-5-4-11-2-1-3-12-6-8-14(15)18(13)17(11)12/h1-9,16,19-22,25-29H,10H2,(H,30,31)/t16-,19?,20-,21+,22-,25?/m1/s1 |
| InChIKey | HTFUYFNZOLKUJJ-JFKQJKEYSA-N |
| XLogP | 1.10 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|