About 2,5-ditert-butyl-5-methyl-1,3-diazepine
2,5-ditert-butyl-5-methyl-1,3-diazepine (PubChem CID 90949983) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,5-ditert-butyl-5-methyl-1,3-diazepine.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-5-methyl-1,3-diazepine |
| PubChem CID | 90949983 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2,5-ditert-butyl-5-methyl-1,3-diazepine |
| SMILES | CC(C)(C)C1=NC=CC(C)(C(C)(C)C)C=N1 |
| InChI | InChI=1S/C14H24N2/c1-12(2,3)11-15-9-8-14(7,10-16-11)13(4,5)6/h8-10H,1-7H3 |
| InChIKey | HMQGLYXSMHPRMP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-ditert-butyl-5-methyl-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-5-methyl-1,3-diazepine?
The IUPAC name of 2,5-ditert-butyl-5-methyl-1,3-diazepine (CID 90949983) is 2,5-ditert-butyl-5-methyl-1,3-diazepine.
What is the SMILES notation for 2,5-ditert-butyl-5-methyl-1,3-diazepine?
The canonical SMILES for 2,5-ditert-butyl-5-methyl-1,3-diazepine is CC(C)(C)C1=NC=CC(C)(C(C)(C)C)C=N1.
What is the InChIKey of 2,5-ditert-butyl-5-methyl-1,3-diazepine?
The InChIKey is HMQGLYXSMHPRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-12(2,3)11-15-9-8-14(7,10-16-11)13(4,5)6/h8-10H,1-7H3.
What are the key properties of 2,5-ditert-butyl-5-methyl-1,3-diazepine?
2,5-ditert-butyl-5-methyl-1,3-diazepine has a molecular weight of 220.36 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-5-methyl-1,3-diazepine is sourced from PubChem (CID 90949983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).