C15H28OS — CID 90950241
2-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-ylsulfanyl]ethanol (PubChem CID 90950241) has the molecular formula C15H28OS and a molecular weight of 256.45 g/mol. Its IUPAC name is 2-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-ylsulfanyl]ethanol.
| Compound Name | 2-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-ylsulfanyl]ethanol |
|---|---|
| PubChem CID | 90950241 |
| Molecular Formula | C15H28OS |
| Molecular Weight | 256.45 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-[4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-ylsulfanyl]ethanol |
| SMILES | CC1=CCCC(C)(C)C1CCC(C)SCCO |
| InChI | InChI=1S/C15H28OS/c1-12-6-5-9-15(3,4)14(12)8-7-13(2)17-11-10-16/h6,13-14,16H,5,7-11H2,1-4H3 |
| InChIKey | RCOUEPIZQSAYJT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|