About [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate
[3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate (PubChem CID 90950258) has the molecular formula C15H10Br4O4
and a molecular weight of 573.86 g/mol. Its IUPAC name is [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate.
Molecular Properties
| Compound Name | [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate |
| PubChem CID | 90950258 |
| Molecular Formula | C15H10Br4O4 |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 569.73 |
| IUPAC Name | [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(Br)c(Oc2cc(Br)c(O)c(Br)c2)c(Br)c1 |
| InChI | InChI=1S/C15H10Br4O4/c1-2-13(20)22-7-5-11(18)15(12(19)6-7)23-8-3-9(16)14(21)10(17)4-8/h3-6,21H,2H2,1H3 |
| InChIKey | XYMMWQHBLWYMMD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate?
The IUPAC name of [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate (CID 90950258) is [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate.
What is the SMILES notation for [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate?
The canonical SMILES for [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate is CCC(=O)Oc1cc(Br)c(Oc2cc(Br)c(O)c(Br)c2)c(Br)c1.
What is the InChIKey of [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate?
The InChIKey is XYMMWQHBLWYMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Br4O4/c1-2-13(20)22-7-5-11(18)15(12(19)6-7)23-8-3-9(16)14(21)10(17)4-8/h3-6,21H,2H2,1H3.
What are the key properties of [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate?
[3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate has a molecular weight of 573.86 g/mol, XLogP of 6.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dibromo-4-(3,5-dibromo-4-hydroxyphenoxy)phenyl] propanoate is sourced from PubChem (CID 90950258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).