C8H11NO — CID 90950780
4,6,7,8-tetrahydro-3H-2,3-benzoxazine (PubChem CID 90950780) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 4,6,7,8-tetrahydro-3H-2,3-benzoxazine.
| Compound Name | 4,6,7,8-tetrahydro-3H-2,3-benzoxazine |
|---|---|
| PubChem CID | 90950780 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 4,6,7,8-tetrahydro-3H-2,3-benzoxazine |
| SMILES | C1=C2CCCC=C2CNO1 |
| InChI | InChI=1S/C8H11NO/c1-2-4-8-6-10-9-5-7(8)3-1/h3,6,9H,1-2,4-5H2 |
| InChIKey | FAMYKJVNJGIXRV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |