About 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole
2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole (PubChem CID 90950888) has the molecular formula C17H14ClN3O3
and a molecular weight of 343.77 g/mol. Its IUPAC name is 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole.
Molecular Properties
| Compound Name | 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole |
| PubChem CID | 90950888 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole |
| SMILES | COc1ccccc1-c1cc(Cl)c(C2OC=CO2)c(CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C17H14ClN3O3/c1-22-15-5-3-2-4-13(15)11-8-12(10-20-21-19)16(14(18)9-11)17-23-6-7-24-17/h2-9,17H,10H2,1H3 |
| InChIKey | NPFRVJPWZFTHQV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole?
The IUPAC name of 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole (CID 90950888) is 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole.
What is the SMILES notation for 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole?
The canonical SMILES for 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole is COc1ccccc1-c1cc(Cl)c(C2OC=CO2)c(CN=[N+]=[N-])c1.
What is the InChIKey of 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole?
The InChIKey is NPFRVJPWZFTHQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O3/c1-22-15-5-3-2-4-13(15)11-8-12(10-20-21-19)16(14(18)9-11)17-23-6-7-24-17/h2-9,17H,10H2,1H3.
What are the key properties of 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole?
2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole has a molecular weight of 343.77 g/mol, XLogP of 5.34, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(azidomethyl)-6-chloro-4-(2-methoxyphenyl)phenyl]-1,3-dioxole is sourced from PubChem (CID 90950888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).