About 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol
1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol (PubChem CID 90951270) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol |
| PubChem CID | 90951270 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol |
| SMILES | COCCOCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C9H15NO4/c1-7-5-8(11)10(9(7)12)6-14-4-3-13-2/h5,11-12H,3-4,6H2,1-2H3 |
| InChIKey | RROHCZFDXQSGPG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol?
The IUPAC name of 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol (CID 90951270) is 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol.
What is the SMILES notation for 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol?
The canonical SMILES for 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol is COCCOCn1c(O)cc(C)c1O.
What is the InChIKey of 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol?
The InChIKey is RROHCZFDXQSGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-7-5-8(11)10(9(7)12)6-14-4-3-13-2/h5,11-12H,3-4,6H2,1-2H3.
What are the key properties of 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol?
1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol has a molecular weight of 201.22 g/mol, XLogP of 0.83, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethoxymethyl)-3-methylpyrrole-2,5-diol is sourced from PubChem (CID 90951270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).