C21H44O2Si3 — CID 90951281
3-[(1S,2R,3S,4R)-4-ethenyl-2,3-bis(trimethylsilyloxymethyl)cyclopentyl]prop-2-enyl-trimethylsilane (PubChem CID 90951281) has the molecular formula C21H44O2Si3 and a molecular weight of 412.84 g/mol. Its IUPAC name is 3-[(1S,2R,3S,4R)-4-ethenyl-2,3-bis(trimethylsilyloxymethyl)cyclopentyl]prop-2-enyl-trimethylsilane.
| Compound Name | 3-[(1S,2R,3S,4R)-4-ethenyl-2,3-bis(trimethylsilyloxymethyl)cyclopentyl]prop-2-enyl-trimethylsilane |
|---|---|
| PubChem CID | 90951281 |
| Molecular Formula | C21H44O2Si3 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 3-[(1S,2R,3S,4R)-4-ethenyl-2,3-bis(trimethylsilyloxymethyl)cyclopentyl]prop-2-enyl-trimethylsilane |
| SMILES | C=C[C@H]1C[C@@H](C=CC[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)[C@H]1CO[Si](C)(C)C |
| InChI | InChI=1S/C21H44O2Si3/c1-11-18-15-19(13-12-14-24(2,3)4)21(17-23-26(8,9)10)20(18)16-22-25(5,6)7/h11-13,18-21H,1,14-17H2,2-10H3/t18-,19+,20-,21+/m0/s1 |
| InChIKey | LAFMVRWYBVHUEE-JSXRDJHFSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|