C20H29NO2S — CID 90951374
N-(4-methoxyphenyl)-3-(1,3,3-trimethyl-2-sulfanyl-2-bicyclo[2.2.1]heptanyl)propanamide (PubChem CID 90951374) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-(1,3,3-trimethyl-2-sulfanyl-2-bicyclo[2.2.1]heptanyl)propanamide.
| Compound Name | N-(4-methoxyphenyl)-3-(1,3,3-trimethyl-2-sulfanyl-2-bicyclo[2.2.1]heptanyl)propanamide |
|---|---|
| PubChem CID | 90951374 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-(4-methoxyphenyl)-3-(1,3,3-trimethyl-2-sulfanyl-2-bicyclo[2.2.1]heptanyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCC2(S)C3(C)CCC(C3)C2(C)C)cc1 |
| InChI | InChI=1S/C20H29NO2S/c1-18(2)14-9-11-19(3,13-14)20(18,24)12-10-17(22)21-15-5-7-16(23-4)8-6-15/h5-8,14,24H,9-13H2,1-4H3,(H,21,22) |
| InChIKey | VQYGWAWWGQTBGF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|