About N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine
N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine (PubChem CID 90951681) has the molecular formula C20H20F6N2O2
and a molecular weight of 434.38 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine.
Molecular Properties
| Compound Name | N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine |
| PubChem CID | 90951681 |
| Molecular Formula | C20H20F6N2O2 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine |
| SMILES | FC(F)(F)Oc1cc(CNC2CCN(c3ccccc3)CC2)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F6N2O2/c21-19(22,23)29-17-10-14(11-18(12-17)30-20(24,25)26)13-27-15-6-8-28(9-7-15)16-4-2-1-3-5-16/h1-5,10-12,15,27H,6-9,13H2 |
| InChIKey | MQULXEKVDIVTNL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine?
The IUPAC name of N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine (CID 90951681) is N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine.
What is the SMILES notation for N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine?
The canonical SMILES for N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine is FC(F)(F)Oc1cc(CNC2CCN(c3ccccc3)CC2)cc(OC(F)(F)F)c1.
What is the InChIKey of N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine?
The InChIKey is MQULXEKVDIVTNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F6N2O2/c21-19(22,23)29-17-10-14(11-18(12-17)30-20(24,25)26)13-27-15-6-8-28(9-7-15)16-4-2-1-3-5-16/h1-5,10-12,15,27H,6-9,13H2.
What are the key properties of N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine?
N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine has a molecular weight of 434.38 g/mol, XLogP of 5.24, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3,5-bis(trifluoromethoxy)phenyl]methyl]-1-phenylpiperidin-4-amine is sourced from PubChem (CID 90951681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).