C10H9Cl2N3O6 — CID 90951767
5-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)methoxy]-1-hydroxyethyl]-3-hydroxyoxolane-2,4-dione (PubChem CID 90951767) has the molecular formula C10H9Cl2N3O6 and a molecular weight of 338.10 g/mol. Its IUPAC name is 5-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)methoxy]-1-hydroxyethyl]-3-hydroxyoxolane-2,4-dione.
| Compound Name | 5-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)methoxy]-1-hydroxyethyl]-3-hydroxyoxolane-2,4-dione |
|---|---|
| PubChem CID | 90951767 |
| Molecular Formula | C10H9Cl2N3O6 |
| Molecular Weight | 338.10 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 5-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)methoxy]-1-hydroxyethyl]-3-hydroxyoxolane-2,4-dione |
| SMILES | O=C1OC(C(O)COCc2nc(Cl)nc(Cl)n2)C(=O)C1O |
| InChI | InChI=1S/C10H9Cl2N3O6/c11-9-13-4(14-10(12)15-9)2-20-1-3(16)7-5(17)6(18)8(19)21-7/h3,6-7,16,18H,1-2H2 |
| InChIKey | DZHJTPBHBIGNEW-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 131.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.10 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|